Seudónimo Seudónimo
  • 02-03-2019
  • Mathematics
contestada

if a function is linear does that make it positive?

Respuesta :

jimthompson5910 jimthompson5910
  • 02-03-2019

If you mean the y values, then no it doesn't mean it's always positive.

Consider something like y = 3x+2 which is a linear function. It graphs a straight line through the two points (0,2) and (1,5)

If you plugged a number like x = -10, then...

y = 3x+2

y = 3*(-10)+2

y = -30 + 2

y = -28

So we see that y isn't positive here.

Answer Link

Otras preguntas

Suppose a function f has an inverse. If f(2)=6 and f(3)=7, find: f−1(6)
1. Research 5 functions of the frontal lobe and explain them in detail with example. 2. Explain what you think might happen if someone damaged frontal lobe. You
Rachelle buys a drink. She spends the same amount of money on her drink as Chuck spent on his candy. Rachelle now has only 1/3 of the same amount of money that
what is the function of eye lens of the human eye​
find out what's wrong with this graph
plz answer fast i beg u Which are not particles that enable electrical conductivity? Select one: a. delocalised electrons b. molecules c. mobile ions
Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl
mention the major jobs of pharmacist​
Simplify the expression in simplest form (3x - 5)x4 +2
An executive drove from his home at an average speed of 35 mph to an airport where a helicopter was waiting. The executive then boarded the helicopter and flew